| Name | 2-Dodecen-1-ylsuccinic anhydride, mixtureof isomers |
| Synonyms | J-12 DDSA EPON(R) DDSA SUBSTITUTE DODECENYLSUCCINIC ANHYDRIDE ISODODECENYLSUCCINIC ANHYDRIDE DODEC-2-EN-1-YLSUCCINIC ANHYDRIDE Dodecenylsuccinic Anhydride (DDSA) dihydro-3-(tetrapropenyl)furan-2,5-dione 2-Dodecen-1-ylsuccinic anhydride, mixtureof isomers |
| CAS | 26544-38-7 |
| EINECS | 247-781-6 |
| InChI | InChI=1/C16H26O3/c1-10(2)6-11(3)7-12(4)8-13(5)14-9-15(17)19-16(14)18/h8,10-12,14H,6-7,9H2,1-5H3/b13-8+ |
| InChIKey | UYCICMIUKYEYEU-ZHACJKMWSA-N |
| Molecular Formula | C16H26O3 |
| Molar Mass | 266.38 |
| Density | 1.00g/mLat 20°C |
| Melting Point | 41-43°C(lit.) |
| Boling Point | 180-182°C5mm Hg(lit.) |
| Flash Point | 352°F |
| Water Solubility | 20mg/L at 22℃ |
| Solubility | 10g/L in organic solvents at 20 ℃ |
| Vapor Presure | <1 mm Hg ( 20 °C) |
| Vapor Density | 9.2 (vs air) |
| Appearance | clear liquid to cloudy liquid |
| Color | Light yellow to Yellow to Orange |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.477-1.479 |
| MDL | MFCD00005528 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R36/38 - Irritating to eyes and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| RTECS | WN1225000 |
| LogP | 4.39 at 22℃ |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |